C24H19Cl2NO9S — CID 118327987
5-(6,8-dichloro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-carboxylic acid (PubChem CID 118327987) has the molecular formula C24H19Cl2NO9S and a molecular weight of 568.39 g/mol. Its IUPAC name is 5-(6,8-dichloro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-carboxylic acid.
| Compound Name | 5-(6,8-dichloro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 118327987 |
| Molecular Formula | C24H19Cl2NO9S |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | 5-(6,8-dichloro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-carboxylic acid |
| SMILES | O=C(CCCCCc1sc(-c2cc3cc(Cl)c(O)c(Cl)c3oc2=O)cc1C(=O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H19Cl2NO9S/c25-14-9-11-8-13(24(34)35-22(11)20(26)21(14)31)16-10-12(23(32)33)15(37-16)4-2-1-3-5-19(30)36-27-17(28)6-7-18(27)29/h8-10,31H,1-7H2,(H,32,33) |
| InChIKey | WKEDTUYPYPMARV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|