C28H24ClN2O10S+ — CID 59524745
6-chloro-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]quinolin-1-ium-4-yl]-7-hydroxy-2-oxochromene-8-sulfonic acid (PubChem CID 59524745) has the molecular formula C28H24ClN2O10S+ and a molecular weight of 616.02 g/mol. Its IUPAC name is 6-chloro-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]quinolin-1-ium-4-yl]-7-hydroxy-2-oxochromene-8-sulfonic acid.
| Compound Name | 6-chloro-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]quinolin-1-ium-4-yl]-7-hydroxy-2-oxochromene-8-sulfonic acid |
|---|---|
| PubChem CID | 59524745 |
| Molecular Formula | C28H24ClN2O10S+ |
| Molecular Weight | 616.02 g/mol |
| Exact Mass | 615.08 |
| IUPAC Name | 6-chloro-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]quinolin-1-ium-4-yl]-7-hydroxy-2-oxochromene-8-sulfonic acid |
| SMILES | O=C(CCCCC[n+]1ccc(-c2cc3cc(Cl)c(O)c(S(=O)(=O)O)c3oc2=O)c2ccccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H23ClN2O10S/c29-20-15-16-14-19(28(36)40-26(16)27(25(20)35)42(37,38)39)17-11-13-30(21-7-4-3-6-18(17)21)12-5-1-2-8-24(34)41-31-22(32)9-10-23(31)33/h3-4,6-7,11,13-15H,1-2,5,8-10,12H2,(H,37,38,39)/p+1 |
| InChIKey | OXMYUXPHHZSKOX-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.02 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|