C17H18Cl2N2O5 — CID 18006764
(2,5-dioxopyrrolidin-1-yl) 6-[(2,6-dichlorobenzoyl)amino]hexanoate (PubChem CID 18006764) has the molecular formula C17H18Cl2N2O5 and a molecular weight of 401.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[(2,6-dichlorobenzoyl)amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,6-dichlorobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 18006764 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,6-dichlorobenzoyl)amino]hexanoate |
| SMILES | O=C(CCCCCNC(=O)c1c(Cl)cccc1Cl)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H18Cl2N2O5/c18-11-5-4-6-12(19)16(11)17(25)20-10-3-1-2-7-15(24)26-21-13(22)8-9-14(21)23/h4-6H,1-3,7-10H2,(H,20,25) |
| InChIKey | CYAZKZHFYADYGX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|