C15H19N2O4+ — CID 58915923
(2,5-dioxopyrrolidin-1-yl) 5-(4-methylpyridin-1-ium-1-yl)pentanoate (PubChem CID 58915923) has the molecular formula C15H19N2O4+ and a molecular weight of 291.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(4-methylpyridin-1-ium-1-yl)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(4-methylpyridin-1-ium-1-yl)pentanoate |
|---|---|
| PubChem CID | 58915923 |
| Molecular Formula | C15H19N2O4+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(4-methylpyridin-1-ium-1-yl)pentanoate |
| SMILES | Cc1cc[n+](CCCCC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C15H19N2O4/c1-12-7-10-16(11-8-12)9-3-2-4-15(20)21-17-13(18)5-6-14(17)19/h7-8,10-11H,2-6,9H2,1H3/q+1 |
| InChIKey | ATCTWVVRJQDJDU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|