C20H13Cl2NO6S — CID 58571982
(2,5-dioxopyrrolidin-1-yl) 2-[5-(6,8-dichloro-7-methyl-2-oxochromen-3-yl)thiophen-2-yl]acetate (PubChem CID 58571982) has the molecular formula C20H13Cl2NO6S and a molecular weight of 466.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[5-(6,8-dichloro-7-methyl-2-oxochromen-3-yl)thiophen-2-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(6,8-dichloro-7-methyl-2-oxochromen-3-yl)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 58571982 |
| Molecular Formula | C20H13Cl2NO6S |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(6,8-dichloro-7-methyl-2-oxochromen-3-yl)thiophen-2-yl]acetate |
| SMILES | Cc1c(Cl)cc2cc(-c3ccc(CC(=O)ON4C(=O)CCC4=O)s3)c(=O)oc2c1Cl |
| InChI | InChI=1S/C20H13Cl2NO6S/c1-9-13(21)7-10-6-12(20(27)28-19(10)18(9)22)14-3-2-11(30-14)8-17(26)29-23-15(24)4-5-16(23)25/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | CMAGQVPUOBTWMD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|