C23H19F2NO10S2 — CID 91170002
5-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid (PubChem CID 91170002) has the molecular formula C23H19F2NO10S2 and a molecular weight of 571.53 g/mol. Its IUPAC name is 5-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid.
| Compound Name | 5-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid |
|---|---|
| PubChem CID | 91170002 |
| Molecular Formula | C23H19F2NO10S2 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | 5-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-2-[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid |
| SMILES | O=C(CCCCCc1sc(-c2cc3cc(F)c(O)c(F)c3oc2=O)cc1S(=O)(=O)O)On1c(O)ccc1O |
| InChI | InChI=1S/C23H19F2NO10S2/c24-13-9-11-8-12(23(31)35-22(11)20(25)21(13)30)15-10-16(38(32,33)34)14(37-15)4-2-1-3-5-19(29)36-26-17(27)6-7-18(26)28/h6-10,27-28,30H,1-5H2,(H,32,33,34) |
| InChIKey | WMYAQUWKZKXARS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|