C24H23N2O7+ — CID 91556502
(2,5-dihydroxypyrrol-1-yl) 6-[4-(7-hydroxy-2-oxochromen-3-yl)pyridin-1-ium-1-yl]hexanoate (PubChem CID 91556502) has the molecular formula C24H23N2O7+ and a molecular weight of 451.46 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[4-(7-hydroxy-2-oxochromen-3-yl)pyridin-1-ium-1-yl]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[4-(7-hydroxy-2-oxochromen-3-yl)pyridin-1-ium-1-yl]hexanoate |
|---|---|
| PubChem CID | 91556502 |
| Molecular Formula | C24H23N2O7+ |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[4-(7-hydroxy-2-oxochromen-3-yl)pyridin-1-ium-1-yl]hexanoate |
| SMILES | O=C(CCCCC[n+]1ccc(-c2cc3ccc(O)cc3oc2=O)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C24H22N2O7/c27-18-6-5-17-14-19(24(31)32-20(17)15-18)16-9-12-25(13-10-16)11-3-1-2-4-23(30)33-26-21(28)7-8-22(26)29/h5-10,12-15,28-29H,1-4,11H2/p+1 |
| InChIKey | QYFMEOPNMZEXMQ-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|