C14H10F2O6 — CID 160825064
methyl 4-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-4-oxobutanoate (PubChem CID 160825064) has the molecular formula C14H10F2O6 and a molecular weight of 312.22 g/mol. Its IUPAC name is methyl 4-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-4-oxobutanoate.
| Compound Name | methyl 4-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 160825064 |
| Molecular Formula | C14H10F2O6 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | methyl 4-(6,8-difluoro-7-hydroxy-2-oxochromen-3-yl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc2cc(F)c(O)c(F)c2oc1=O |
| InChI | InChI=1S/C14H10F2O6/c1-21-10(18)3-2-9(17)7-4-6-5-8(15)12(19)11(16)13(6)22-14(7)20/h4-5,19H,2-3H2,1H3 |
| InChIKey | LTHAASSMYGPSCU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|