C14H7F2NO7 — CID 56927770
(2,5-dioxopyrrolidin-1-yl) 6,8-difluoro-7-hydroxy-2-oxochromene-3-carboxylate (PubChem CID 56927770) has the molecular formula C14H7F2NO7 and a molecular weight of 339.21 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6,8-difluoro-7-hydroxy-2-oxochromene-3-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6,8-difluoro-7-hydroxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 56927770 |
| Molecular Formula | C14H7F2NO7 |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6,8-difluoro-7-hydroxy-2-oxochromene-3-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc2cc(F)c(O)c(F)c2oc1=O |
| InChI | InChI=1S/C14H7F2NO7/c15-7-4-5-3-6(13(21)23-12(5)10(16)11(7)20)14(22)24-17-8(18)1-2-9(17)19/h3-4,20H,1-2H2 |
| InChIKey | NZYXABPVYJRICY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|