C16H15F2NO9 — CID 118289672
6,8-difluoro-7-hydroxy-2-oxo-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]chromene-3-carboxamide (PubChem CID 118289672) has the molecular formula C16H15F2NO9 and a molecular weight of 403.29 g/mol. Its IUPAC name is 6,8-difluoro-7-hydroxy-2-oxo-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]chromene-3-carboxamide.
| Compound Name | 6,8-difluoro-7-hydroxy-2-oxo-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 118289672 |
| Molecular Formula | C16H15F2NO9 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 6,8-difluoro-7-hydroxy-2-oxo-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]chromene-3-carboxamide |
| SMILES | O=C[C@H](NC(=O)c1cc2cc(F)c(O)c(F)c2oc1=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H15F2NO9/c17-7-2-5-1-6(16(27)28-14(5)10(18)11(7)23)15(26)19-8(3-20)12(24)13(25)9(22)4-21/h1-3,8-9,12-13,21-25H,4H2,(H,19,26)/t8-,9+,12+,13+/m0/s1 |
| InChIKey | BMZYHOQYRLYOEE-HIAZDOBYSA-N |
| XLogP | -1.85 |
| TPSA | 177.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|