C15H9ClO7S2 — CID 118327988
2-[5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-3-sulfinothiophen-2-yl]acetic acid (PubChem CID 118327988) has the molecular formula C15H9ClO7S2 and a molecular weight of 400.82 g/mol. Its IUPAC name is 2-[5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-3-sulfinothiophen-2-yl]acetic acid.
| Compound Name | 2-[5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-3-sulfinothiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 118327988 |
| Molecular Formula | C15H9ClO7S2 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 2-[5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-3-sulfinothiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(-c2cc3cc(Cl)c(O)cc3oc2=O)cc1S(=O)O |
| InChI | InChI=1S/C15H9ClO7S2/c16-8-2-6-1-7(15(20)23-10(6)3-9(8)17)11-4-13(25(21)22)12(24-11)5-14(18)19/h1-4,17H,5H2,(H,18,19)(H,21,22) |
| InChIKey | KXXDBZAOQWEIRH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|