C13H10ClNO6 — CID 92845763
3-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]propanoic acid (PubChem CID 92845763) has the molecular formula C13H10ClNO6 and a molecular weight of 311.68 g/mol. Its IUPAC name is 3-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 92845763 |
| Molecular Formula | C13H10ClNO6 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-[(6-chloro-7-hydroxy-2-oxochromene-3-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1cc2cc(Cl)c(O)cc2oc1=O |
| InChI | InChI=1S/C13H10ClNO6/c14-8-4-6-3-7(12(19)15-2-1-11(17)18)13(20)21-10(6)5-9(8)16/h3-5,16H,1-2H2,(H,15,19)(H,17,18) |
| InChIKey | FIVSHWIMNFNJED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|