C15H9IO4 — CID 23371948
6,7-dihydroxy-3-(4-iodophenyl)chromen-2-one (PubChem CID 23371948) has the molecular formula C15H9IO4 and a molecular weight of 380.14 g/mol. Its IUPAC name is 6,7-dihydroxy-3-(4-iodophenyl)chromen-2-one.
| Compound Name | 6,7-dihydroxy-3-(4-iodophenyl)chromen-2-one |
|---|---|
| PubChem CID | 23371948 |
| Molecular Formula | C15H9IO4 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 6,7-dihydroxy-3-(4-iodophenyl)chromen-2-one |
| SMILES | O=c1oc2cc(O)c(O)cc2cc1-c1ccc(I)cc1 |
| InChI | InChI=1S/C15H9IO4/c16-10-3-1-8(2-4-10)11-5-9-6-12(17)13(18)7-14(9)20-15(11)19/h1-7,17-18H |
| InChIKey | CXXTZLWZRADCML-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|