C16H10O6 — CID 139592645
3-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-6,7-dihydroxychromen-2-one (PubChem CID 139592645) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-6,7-dihydroxychromen-2-one.
| Compound Name | 3-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-6,7-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 139592645 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-6,7-dihydroxychromen-2-one |
| SMILES | O=c1oc2cc(O)c(O)cc2cc1-c1ccc2cc1OCO2 |
| InChI | InChI=1S/C16H10O6/c17-12-4-8-3-11(16(19)22-14(8)6-13(12)18)10-2-1-9-5-15(10)21-7-20-9/h1-6,17-18H,7H2 |
| InChIKey | RWGPLUGVNCFULH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|