C20H18O6 — CID 162964938
(2R)-6-(2,4-dihydroxyphenyl)-2-(hydroxymethyl)-3,3-dimethyl-2H-furo[3,2-g]chromen-7-one (PubChem CID 162964938) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2R)-6-(2,4-dihydroxyphenyl)-2-(hydroxymethyl)-3,3-dimethyl-2H-furo[3,2-g]chromen-7-one.
| Compound Name | (2R)-6-(2,4-dihydroxyphenyl)-2-(hydroxymethyl)-3,3-dimethyl-2H-furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 162964938 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2R)-6-(2,4-dihydroxyphenyl)-2-(hydroxymethyl)-3,3-dimethyl-2H-furo[3,2-g]chromen-7-one |
| SMILES | CC1(C)c2cc3cc(-c4ccc(O)cc4O)c(=O)oc3cc2O[C@H]1CO |
| InChI | InChI=1S/C20H18O6/c1-20(2)14-6-10-5-13(12-4-3-11(22)7-15(12)23)19(24)26-16(10)8-17(14)25-18(20)9-21/h3-8,18,21-23H,9H2,1-2H3/t18-/m0/s1 |
| InChIKey | HHSWLOSLMYIVFG-SFHVURJKSA-N |
| XLogP | 2.90 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|