C16H10O7 — CID 86288794
4,5-dihydroxy-2-(6-hydroxy-2-oxochromen-3-yl)benzoic acid (PubChem CID 86288794) has the molecular formula C16H10O7 and a molecular weight of 314.25 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(6-hydroxy-2-oxochromen-3-yl)benzoic acid.
| Compound Name | 4,5-dihydroxy-2-(6-hydroxy-2-oxochromen-3-yl)benzoic acid |
|---|---|
| PubChem CID | 86288794 |
| Molecular Formula | C16H10O7 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4,5-dihydroxy-2-(6-hydroxy-2-oxochromen-3-yl)benzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)cc1-c1cc2cc(O)ccc2oc1=O |
| InChI | InChI=1S/C16H10O7/c17-8-1-2-14-7(3-8)4-11(16(22)23-14)9-5-12(18)13(19)6-10(9)15(20)21/h1-6,17-19H,(H,20,21) |
| InChIKey | SCAURLDVWSAPGC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|