C27H29N3O11S3 — CID 130422551
5-[7-[[8-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-8-oxooctan-2-yl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid (PubChem CID 130422551) has the molecular formula C27H29N3O11S3 and a molecular weight of 667.74 g/mol. Its IUPAC name is 5-[7-[[8-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-8-oxooctan-2-yl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid.
| Compound Name | 5-[7-[[8-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-8-oxooctan-2-yl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
|---|---|
| PubChem CID | 130422551 |
| Molecular Formula | C27H29N3O11S3 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.10 |
| IUPAC Name | 5-[7-[[8-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-8-oxooctan-2-yl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
| SMILES | CC(CCCCCC(=O)NCCN1C(=O)C=CC1=O)Nc1ccc2cc(-c3sc(S(=O)(=O)O)cc3S(=O)(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C27H29N3O11S3/c1-16(5-3-2-4-6-22(31)28-11-12-30-23(32)9-10-24(30)33)29-18-8-7-17-13-19(27(34)41-20(17)14-18)26-21(43(35,36)37)15-25(42-26)44(38,39)40/h7-10,13-16,29H,2-6,11-12H2,1H3,(H,28,31)(H,35,36,37)(H,38,39,40) |
| InChIKey | RYHBSRFSFOBTGF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 217.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|