C30H35N2O6S+ — CID 173054464
[4-tert-butyl-2-[2-[7-[ethyl(sulfo)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-diethylazanium (PubChem CID 173054464) has the molecular formula C30H35N2O6S+ and a molecular weight of 551.69 g/mol. Its IUPAC name is [4-tert-butyl-2-[2-[7-[ethyl(sulfo)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-diethylazanium.
| Compound Name | [4-tert-butyl-2-[2-[7-[ethyl(sulfo)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 173054464 |
| Molecular Formula | C30H35N2O6S+ |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | [4-tert-butyl-2-[2-[7-[ethyl(sulfo)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-diethylazanium |
| SMILES | CCN(c1ccc2cc(C=Cc3cc(C(C)(C)C)c4ccc(=[N+](CC)CC)cc-4o3)c(=O)oc2c1)S(=O)(=O)O |
| InChI | InChI=1S/C30H34N2O6S/c1-7-31(8-2)22-13-15-25-26(30(4,5)6)19-24(37-28(25)17-22)14-11-21-16-20-10-12-23(18-27(20)38-29(21)33)32(9-3)39(34,35)36/h10-19H,7-9H2,1-6H3/p+1 |
| InChIKey | BZLRIVUMQAIDOE-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|