C42H59N2O4S+ — CID 145127876
[4-tert-butyl-2-[(1E,3E,5E)-5-[3,3-dimethyl-1-(6-methylhept-6-enyl)-5-sulfoindol-2-ylidene]penta-1,3-dienyl]chromen-7-ylidene]-diethylazanium;ethane (PubChem CID 145127876) has the molecular formula C42H59N2O4S+ and a molecular weight of 688.01 g/mol. Its IUPAC name is [4-tert-butyl-2-[(1E,3E,5E)-5-[3,3-dimethyl-1-(6-methylhept-6-enyl)-5-sulfoindol-2-ylidene]penta-1,3-dienyl]chromen-7-ylidene]-diethylazanium;ethane.
| Compound Name | [4-tert-butyl-2-[(1E,3E,5E)-5-[3,3-dimethyl-1-(6-methylhept-6-enyl)-5-sulfoindol-2-ylidene]penta-1,3-dienyl]chromen-7-ylidene]-diethylazanium;ethane |
|---|---|
| PubChem CID | 145127876 |
| Molecular Formula | C42H59N2O4S+ |
| Molecular Weight | 688.01 g/mol |
| Exact Mass | 687.42 |
| IUPAC Name | [4-tert-butyl-2-[(1E,3E,5E)-5-[3,3-dimethyl-1-(6-methylhept-6-enyl)-5-sulfoindol-2-ylidene]penta-1,3-dienyl]chromen-7-ylidene]-diethylazanium;ethane |
| SMILES | C=C(C)CCCCCN1/C(=C/C=C/C=C/c2cc(C(C)(C)C)c3ccc(=[N+](CC)CC)cc-3o2)C(C)(C)c2cc(S(=O)(=O)O)ccc21.CC |
| InChI | InChI=1S/C40H52N2O4S.C2H6/c1-10-41(11-2)30-21-23-33-34(39(5,6)7)27-31(46-37(33)26-30)19-15-12-16-20-38-40(8,9)35-28-32(47(43,44)45)22-24-36(35)42(38)25-17-13-14-18-29(3)4;1-2/h12,15-16,19-24,26-28H,3,10-11,13-14,17-18,25H2,1-2,4-9H3;1-2H3/p+1 |
| InChIKey | XJGZJNDZGHNJCS-UHFFFAOYSA-O |
| XLogP | 10.15 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.01 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|