C30H37N2O5S+ — CID 58350903
4-[6-ethyl-2,2,18,18-tetramethyl-16-(sulfomethyl)-19-aza-6-azoniapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5,9,11,13,15(20),16-octaen-19-yl]butanoic acid (PubChem CID 58350903) has the molecular formula C30H37N2O5S+ and a molecular weight of 537.70 g/mol. Its IUPAC name is 4-[6-ethyl-2,2,18,18-tetramethyl-16-(sulfomethyl)-19-aza-6-azoniapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5,9,11,13,15(20),16-octaen-19-yl]butanoic acid.
| Compound Name | 4-[6-ethyl-2,2,18,18-tetramethyl-16-(sulfomethyl)-19-aza-6-azoniapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5,9,11,13,15(20),16-octaen-19-yl]butanoic acid |
|---|---|
| PubChem CID | 58350903 |
| Molecular Formula | C30H37N2O5S+ |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 4-[6-ethyl-2,2,18,18-tetramethyl-16-(sulfomethyl)-19-aza-6-azoniapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),3,5,9,11,13,15(20),16-octaen-19-yl]butanoic acid |
| SMILES | CC[N+]1=c2cc3c(cc2CC1)=Cc1cc2c(cc1C3(C)C)N(CCCC(=O)O)C(C)(C)C=C2CS(=O)(=O)O |
| InChI | InChI=1S/C30H36N2O5S/c1-6-31-11-9-19-12-20-13-21-14-23-22(18-38(35,36)37)17-29(2,3)32(10-7-8-28(33)34)27(23)16-25(21)30(4,5)24(20)15-26(19)31/h12-17H,6-11,18H2,1-5H3,(H-,33,34,35,36,37)/p+1 |
| InChIKey | SNCYNYPSDSONPY-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|