C24H27N2O4+ — CID 142382159
4-(6,8,8-trimethyl-2-oxo-3-pyridin-1-ium-4-yl-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid (PubChem CID 142382159) has the molecular formula C24H27N2O4+ and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-(6,8,8-trimethyl-2-oxo-3-pyridin-1-ium-4-yl-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid.
| Compound Name | 4-(6,8,8-trimethyl-2-oxo-3-pyridin-1-ium-4-yl-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid |
|---|---|
| PubChem CID | 142382159 |
| Molecular Formula | C24H27N2O4+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(6,8,8-trimethyl-2-oxo-3-pyridin-1-ium-4-yl-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid |
| SMILES | CC1CC(C)(C)N(CCCC(=O)O)c2cc3oc(=O)c(-c4cc[nH+]cc4)cc3cc21 |
| InChI | InChI=1S/C24H26N2O4/c1-15-14-24(2,3)26(10-4-5-22(27)28)20-13-21-17(11-18(15)20)12-19(23(29)30-21)16-6-8-25-9-7-16/h6-9,11-13,15H,4-5,10,14H2,1-3H3,(H,27,28)/p+1 |
| InChIKey | HNMZQZYITTUZJX-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|