C30H39N2O4+ — CID 164531724
4-[6,8,8-trimethyl-2-oxo-3-(2-propan-2-yl-1-propylpyridin-1-ium-4-yl)-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid (PubChem CID 164531724) has the molecular formula C30H39N2O4+ and a molecular weight of 491.65 g/mol. Its IUPAC name is 4-[6,8,8-trimethyl-2-oxo-3-(2-propan-2-yl-1-propylpyridin-1-ium-4-yl)-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid.
| Compound Name | 4-[6,8,8-trimethyl-2-oxo-3-(2-propan-2-yl-1-propylpyridin-1-ium-4-yl)-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 164531724 |
| Molecular Formula | C30H39N2O4+ |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 4-[6,8,8-trimethyl-2-oxo-3-(2-propan-2-yl-1-propylpyridin-1-ium-4-yl)-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
| SMILES | CCC[n+]1ccc(-c2cc3cc4c(cc3oc2=O)N(CCCC(=O)O)C(C)(C)CC4C)cc1C(C)C |
| InChI | InChI=1S/C30H38N2O4/c1-7-11-31-13-10-21(16-25(31)19(2)3)24-15-22-14-23-20(4)18-30(5,6)32(12-8-9-28(33)34)26(23)17-27(22)36-29(24)35/h10,13-17,19-20H,7-9,11-12,18H2,1-6H3/p+1 |
| InChIKey | VXBYYLYGAZESLF-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|