C28H37N4O3S2+ — CID 89364410
1-(6,7,7,17,19,19,20-heptamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N-(2-sulfanylethyl)methanesulfonamide (PubChem CID 89364410) has the molecular formula C28H37N4O3S2+ and a molecular weight of 541.76 g/mol. Its IUPAC name is 1-(6,7,7,17,19,19,20-heptamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N-(2-sulfanylethyl)methanesulfonamide.
| Compound Name | 1-(6,7,7,17,19,19,20-heptamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N-(2-sulfanylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 89364410 |
| Molecular Formula | C28H37N4O3S2+ |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 1-(6,7,7,17,19,19,20-heptamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N-(2-sulfanylethyl)methanesulfonamide |
| SMILES | CC1CC(C)(C)N(C)c2cc3c(cc21)N=c1cc2c(cc1O3)=[N+](C)C(C)(C)C=C2CS(=O)(=O)NCCS |
| InChI | InChI=1S/C28H36N4O3S2/c1-17-14-27(2,3)31(6)23-12-25-21(10-19(17)23)30-22-11-20-18(16-37(33,34)29-8-9-36)15-28(4,5)32(7)24(20)13-26(22)35-25/h10-13,15,17,29H,8-9,14,16H2,1-7H3/p+1 |
| InChIKey | OLJNLPVYFJLZSI-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|