C12H24O12S3 — CID 173057683
benzene-1,2,4-triol;ethanesulfonic acid (PubChem CID 173057683) has the molecular formula C12H24O12S3 and a molecular weight of 456.51 g/mol. Its IUPAC name is benzene-1,2,4-triol;ethanesulfonic acid.
| Compound Name | benzene-1,2,4-triol;ethanesulfonic acid |
|---|---|
| PubChem CID | 173057683 |
| Molecular Formula | C12H24O12S3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | benzene-1,2,4-triol;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.CCS(=O)(=O)O.CCS(=O)(=O)O.Oc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C6H6O3.3C2H6O3S/c7-4-1-2-5(8)6(9)3-4;3*1-2-6(3,4)5/h1-3,7-9H;3*2H2,1H3,(H,3,4,5) |
| InChIKey | ISWGVZAPLBJQDI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|