C14H13N3O4 — CID 14690257
ethyl 7,8-dimethyl-6-oxopyrano[3,2-f]benzotriazole-3-carboxylate (PubChem CID 14690257) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is ethyl 7,8-dimethyl-6-oxopyrano[3,2-f]benzotriazole-3-carboxylate.
| Compound Name | ethyl 7,8-dimethyl-6-oxopyrano[3,2-f]benzotriazole-3-carboxylate |
|---|---|
| PubChem CID | 14690257 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | ethyl 7,8-dimethyl-6-oxopyrano[3,2-f]benzotriazole-3-carboxylate |
| SMILES | CCOC(=O)n1nnc2cc3c(C)c(C)c(=O)oc3cc21 |
| InChI | InChI=1S/C14H13N3O4/c1-4-20-14(19)17-11-6-12-9(5-10(11)15-16-17)7(2)8(3)13(18)21-12/h5-6H,4H2,1-3H3 |
| InChIKey | UZDRKKCZYLQJDW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|