C9H11N5 — CID 129287150
N-methyl-8-(methylideneamino)-5,6-dihydropyrido[2,3-b]pyrazin-7-amine (PubChem CID 129287150) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is N-methyl-8-(methylideneamino)-5,6-dihydropyrido[2,3-b]pyrazin-7-amine.
| Compound Name | N-methyl-8-(methylideneamino)-5,6-dihydropyrido[2,3-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 129287150 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-methyl-8-(methylideneamino)-5,6-dihydropyrido[2,3-b]pyrazin-7-amine |
| SMILES | C=NC1=C(NC)CNc2nccnc21 |
| InChI | InChI=1S/C9H11N5/c1-10-6-5-14-9-8(7(6)11-2)12-3-4-13-9/h3-4,10H,2,5H2,1H3,(H,13,14) |
| InChIKey | CSSAQJURUIFBLO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|