C29H33F6NO4S — CID 129287555
ethyl (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-butoxysulfanyl-6-phenyl-2,5-dihydropyridine-3-carboxylate (PubChem CID 129287555) has the molecular formula C29H33F6NO4S and a molecular weight of 605.64 g/mol. Its IUPAC name is ethyl (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-butoxysulfanyl-6-phenyl-2,5-dihydropyridine-3-carboxylate.
| Compound Name | ethyl (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-butoxysulfanyl-6-phenyl-2,5-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 129287555 |
| Molecular Formula | C29H33F6NO4S |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | ethyl (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-butoxysulfanyl-6-phenyl-2,5-dihydropyridine-3-carboxylate |
| SMILES | CCCCOSN1CC(C(=O)OCC)=CC[C@@]1(CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C29H33F6NO4S/c1-4-6-14-40-41-36-18-21(26(37)38-5-2)12-13-27(36,23-10-8-7-9-11-23)19-39-20(3)22-15-24(28(30,31)32)17-25(16-22)29(33,34)35/h7-12,15-17,20H,4-6,13-14,18-19H2,1-3H3/t20-,27-/m1/s1 |
| InChIKey | BETPRQJBFTVKSK-NFQMXDRXSA-N |
| XLogP | 8.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|