C33H35F3N6O3S — CID 129289817
1-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-yl]-3-[5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentan-2-yl]urea (PubChem CID 129289817) has the molecular formula C33H35F3N6O3S and a molecular weight of 652.74 g/mol. Its IUPAC name is 1-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-yl]-3-[5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentan-2-yl]urea.
| Compound Name | 1-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-yl]-3-[5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentan-2-yl]urea |
|---|---|
| PubChem CID | 129289817 |
| Molecular Formula | C33H35F3N6O3S |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | 1-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-yl]-3-[5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentan-2-yl]urea |
| SMILES | Cc1cc(C)c(N2C(=O)CSC2NC(=O)NC(C)CCCc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C33H35F3N6O3S/c1-20-16-21(2)29(22(3)17-20)42-28(43)18-46-32(42)39-31(44)38-23(4)6-5-7-24-8-10-25(11-9-24)30-37-19-41(40-30)26-12-14-27(15-13-26)45-33(34,35)36/h8-17,19,23,32H,5-7,18H2,1-4H3,(H2,38,39,44) |
| InChIKey | PNQRVXPAUQWCSA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |