C9H7F3O2 — CID 129291540
3,5-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 129291540) has the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. Its IUPAC name is 3,5-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3,5-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 129291540 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3,5-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(C(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C9H7F3O2/c1-4-3-6(13)7(9(10,11)12)5(2)8(4)14/h3H,1-2H3 |
| InChIKey | FBSICXRHJHSLCR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|