C8H8F6O — CID 53395688
1,1,1,7,7,7-hexafluoro-5-methylhept-4-en-3-one (PubChem CID 53395688) has the molecular formula C8H8F6O and a molecular weight of 234.14 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-5-methylhept-4-en-3-one.
| Compound Name | 1,1,1,7,7,7-hexafluoro-5-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 53395688 |
| Molecular Formula | C8H8F6O |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-5-methylhept-4-en-3-one |
| SMILES | CC(=CC(=O)CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C8H8F6O/c1-5(3-7(9,10)11)2-6(15)4-8(12,13)14/h2H,3-4H2,1H3 |
| InChIKey | WJDQWIRUUMDSKH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|