C29H36N4O2S — CID 129293655
N-[4-[1-[4-[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]piperazin-1-yl]ethenyl]phenyl]-2-(ethylideneamino)-3-methylbenzenesulfonamide (PubChem CID 129293655) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is N-[4-[1-[4-[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]piperazin-1-yl]ethenyl]phenyl]-2-(ethylideneamino)-3-methylbenzenesulfonamide.
| Compound Name | N-[4-[1-[4-[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]piperazin-1-yl]ethenyl]phenyl]-2-(ethylideneamino)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 129293655 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-[4-[1-[4-[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]piperazin-1-yl]ethenyl]phenyl]-2-(ethylideneamino)-3-methylbenzenesulfonamide |
| SMILES | C=C(C)/C=C(\C(=C)C)N1CCN(C(=C)c2ccc(NS(=O)(=O)c3cccc(C)c3/N=C/C)cc2)CC1 |
| InChI | InChI=1S/C29H36N4O2S/c1-8-30-29-23(6)10-9-11-28(29)36(34,35)31-26-14-12-25(13-15-26)24(7)32-16-18-33(19-17-32)27(22(4)5)20-21(2)3/h8-15,20,31H,2,4,7,16-19H2,1,3,5-6H3/b27-20+,30-8+ |
| InChIKey | MKVQBCJANXJXSC-KIUGRISVSA-N |
| XLogP | 6.14 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|