C28H30N4O3S — CID 129293676
N-[4-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]phenyl]-3,4-dihydroquinoline-8-sulfonamide (PubChem CID 129293676) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is N-[4-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]phenyl]-3,4-dihydroquinoline-8-sulfonamide.
| Compound Name | N-[4-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]phenyl]-3,4-dihydroquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 129293676 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[4-[4-(3,4-dimethylphenyl)piperazine-1-carbonyl]phenyl]-3,4-dihydroquinoline-8-sulfonamide |
| SMILES | Cc1ccc(N2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5c4N=CCC5)cc3)CC2)cc1C |
| InChI | InChI=1S/C28H30N4O3S/c1-20-8-13-25(19-21(20)2)31-15-17-32(18-16-31)28(33)23-9-11-24(12-10-23)30-36(34,35)26-7-3-5-22-6-4-14-29-27(22)26/h3,5,7-14,19,30H,4,6,15-18H2,1-2H3 |
| InChIKey | CSNACOWPASIGEC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|