C29H28O7 — CID 129294574
[(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 129294574) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 129294574 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C\[C@@H](OC(=O)[C@@H](C)c4ccc5cc(OC)ccc5c4)[C@H]12)OC3=O |
| InChI | InChI=1S/C29H28O7/c1-15-9-23-13-21(29(32)34-23)14-25-26(17(3)28(31)36-25)24(10-15)35-27(30)16(2)18-5-6-20-12-22(33-4)8-7-19(20)11-18/h5-8,10-13,16,23-26H,3,9,14H2,1-2,4H3/b15-10-/t16-,23+,24+,25-,26-/m0/s1 |
| InChIKey | WPAYOJJVMAJLDL-YDEBCHLLSA-N |
| XLogP | 4.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|