C21H23ClO7 — CID 67445718
[4-(1-chloroethoxycarbonyloxy)oxolan-3-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 67445718) has the molecular formula C21H23ClO7 and a molecular weight of 422.86 g/mol. Its IUPAC name is [4-(1-chloroethoxycarbonyloxy)oxolan-3-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [4-(1-chloroethoxycarbonyloxy)oxolan-3-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 67445718 |
| Molecular Formula | C21H23ClO7 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [4-(1-chloroethoxycarbonyloxy)oxolan-3-yl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OC3COCC3OC(=O)OC(C)Cl)ccc2c1 |
| InChI | InChI=1S/C21H23ClO7/c1-12(14-4-5-16-9-17(25-3)7-6-15(16)8-14)20(23)28-18-10-26-11-19(18)29-21(24)27-13(2)22/h4-9,12-13,18-19H,10-11H2,1-3H3/t12-,13?,18?,19?/m0/s1 |
| InChIKey | QLXQHLUSLXCNKR-PPQKOSGMSA-N |
| XLogP | 4.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|