About [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate
[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 23277003) has the molecular formula C20H24O8
and a molecular weight of 392.40 g/mol. Its IUPAC name is [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 23277003 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)OC3C(O)C(O)OC(CO)C3O)ccc2c1 |
| InChI | InChI=1S/C20H24O8/c1-10(11-3-4-13-8-14(26-2)6-5-12(13)7-11)19(24)28-18-16(22)15(9-21)27-20(25)17(18)23/h3-8,10,15-18,20-23,25H,9H2,1-2H3 |
| InChIKey | NUIRBEXVHCDUBM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate (CID 23277003) is [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc(C(C)C(=O)OC3C(O)C(O)OC(CO)C3O)ccc2c1.
What is the InChIKey of [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is NUIRBEXVHCDUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O8/c1-10(11-3-4-13-8-14(26-2)6-5-12(13)7-11)19(24)28-18-16(22)15(9-21)27-20(25)17(18)23/h3-8,10,15-18,20-23,25H,9H2,1-2H3.
What are the key properties of [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate?
[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 392.40 g/mol, XLogP of 0.29, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] 2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 23277003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).