C17H18O6 — CID 129294599
[(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] acetate (PubChem CID 129294599) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] acetate.
| Compound Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] acetate |
|---|---|
| PubChem CID | 129294599 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(C)=O)[C@H]12)OC3=O |
| InChI | InChI=1S/C17H18O6/c1-8-4-12-6-11(17(20)22-12)7-14-15(9(2)16(19)23-14)13(5-8)21-10(3)18/h5-6,12-15H,2,4,7H2,1,3H3/b8-5+/t12-,13-,14+,15+/m1/s1 |
| InChIKey | ODMNENMPCGOZAL-ZJEMVAMWSA-N |
| XLogP | 1.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|