C27H24O6 — CID 172653157
[(3S,7R,9Z,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-naphthalen-1-ylacetate (PubChem CID 172653157) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(3S,7R,9Z,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [(3S,7R,9Z,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 172653157 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [(3S,7R,9Z,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-naphthalen-1-ylacetate |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C\C(OC(=O)Cc4cccc5ccccc45)[C@H]12)OC3=O |
| InChI | InChI=1S/C27H24O6/c1-15-10-20-12-19(27(30)31-20)13-23-25(16(2)26(29)33-23)22(11-15)32-24(28)14-18-8-5-7-17-6-3-4-9-21(17)18/h3-9,11-12,20,22-23,25H,2,10,13-14H2,1H3/b15-11-/t20-,22?,23+,25+/m1/s1 |
| InChIKey | JPEGNKAXYSEQDC-MMZBXMRISA-N |
| XLogP | 3.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|