C23H22O6 — CID 129289538
[(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 129289538) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 129289538 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | C=C1OC2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)/C=C/c4ccco4)[C@@H]2C1=C)OC3=O |
| InChI | InChI=1S/C23H22O6/c1-13-9-18-11-16(23(25)28-18)12-20-22(14(2)15(3)27-20)19(10-13)29-21(24)7-6-17-5-4-8-26-17/h4-8,10-11,18-20,22H,2-3,9,12H2,1H3/b7-6+,13-10+/t18-,19-,20?,22+/m1/s1 |
| InChIKey | FIYMWXJYGMCFQB-WVUNAVCOSA-N |
| XLogP | 3.88 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|