C20H20O6S — CID 139540659
(3S,7R,8R,9E,12R)-8-[hydroxy(thiophen-2-yl)methoxy]-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-diene-5,14-dione (PubChem CID 139540659) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is (3S,7R,8R,9E,12R)-8-[hydroxy(thiophen-2-yl)methoxy]-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-diene-5,14-dione.
| Compound Name | (3S,7R,8R,9E,12R)-8-[hydroxy(thiophen-2-yl)methoxy]-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-diene-5,14-dione |
|---|---|
| PubChem CID | 139540659 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (3S,7R,8R,9E,12R)-8-[hydroxy(thiophen-2-yl)methoxy]-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-diene-5,14-dione |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(O)c4cccs4)[C@H]12)OC3=O |
| InChI | InChI=1S/C20H20O6S/c1-10-6-13-8-12(19(22)24-13)9-15-17(11(2)18(21)25-15)14(7-10)26-20(23)16-4-3-5-27-16/h3-5,7-8,13-15,17,20,23H,2,6,9H2,1H3/b10-7+/t13-,14-,15+,17+,20?/m1/s1 |
| InChIKey | RUHQPMLPMOUKIH-MXOFRJRDSA-N |
| XLogP | 2.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|