C27H28O6 — CID 129289559
[(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(3-ethoxyphenyl)prop-2-enoate (PubChem CID 129289559) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(3-ethoxyphenyl)prop-2-enoate.
| Compound Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129289559 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(3-ethoxyphenyl)prop-2-enoate |
| SMILES | C=C1OC2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)/C=C/c4cccc(OCC)c4)[C@@H]2C1=C)OC3=O |
| InChI | InChI=1S/C27H28O6/c1-5-30-21-8-6-7-19(13-21)9-10-25(28)33-23-12-16(2)11-22-14-20(27(29)32-22)15-24-26(23)17(3)18(4)31-24/h6-10,12-14,22-24,26H,3-5,11,15H2,1-2H3/b10-9+,16-12+/t22-,23-,24?,26+/m1/s1 |
| InChIKey | KMYQUENGKMIMIP-DOEYSFDOSA-N |
| XLogP | 4.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|