C26H24O7 — CID 129289568
[(3S,7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 129289568) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(3S,7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 129289568 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C=C1O[C@H]2CC3=C[C@@H](C/C(C)=C\[C@@H](OC(=O)/C=C/c4ccc5c(c4)OCO5)[C@@H]2C1=C)OC3=O |
| InChI | InChI=1S/C26H24O7/c1-14-8-19-11-18(26(28)32-19)12-23-25(15(2)16(3)31-23)22(9-14)33-24(27)7-5-17-4-6-20-21(10-17)30-13-29-20/h4-7,9-11,19,22-23,25H,2-3,8,12-13H2,1H3/b7-5+,14-9-/t19-,22-,23+,25+/m1/s1 |
| InChIKey | VTCOCXJIEHQZNY-IXTOIAISSA-N |
| XLogP | 4.02 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|