C25H22O8 — CID 129294651
[(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 129294651) has the molecular formula C25H22O8 and a molecular weight of 450.44 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 129294651 |
| Molecular Formula | C25H22O8 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C\[C@@H](OC(=O)/C=C/c4ccc5c(c4)OCO5)[C@H]12)OC3=O |
| InChI | InChI=1S/C25H22O8/c1-13-7-17-10-16(25(28)31-17)11-21-23(14(2)24(27)33-21)20(8-13)32-22(26)6-4-15-3-5-18-19(9-15)30-12-29-18/h3-6,8-10,17,20-21,23H,2,7,11-12H2,1H3/b6-4+,13-8-/t17-,20-,21+,23+/m1/s1 |
| InChIKey | JPZURHUUFFKSGO-QACULWAGSA-N |
| XLogP | 3.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|