C26H26O7 — CID 129289510
[(7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 129289510) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [(7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129289510 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [(7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | C=C1C(=O)OC2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)/C=C/c4ccc(OCC)cc4)[C@H]12)OC3=O |
| InChI | InChI=1S/C26H26O7/c1-4-30-19-8-5-17(6-9-19)7-10-23(27)32-21-12-15(2)11-20-13-18(26(29)31-20)14-22-24(21)16(3)25(28)33-22/h5-10,12-13,20-22,24H,3-4,11,14H2,1-2H3/b10-7+,15-12+/t20-,21-,22?,24+/m1/s1 |
| InChIKey | FRPSDMYJMMRUAB-MCZLKDLHSA-N |
| XLogP | 3.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|