C29H28O7 — CID 129294626
[(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-methoxy-2-naphthalen-2-ylpropanoate (PubChem CID 129294626) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-methoxy-2-naphthalen-2-ylpropanoate.
| Compound Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-methoxy-2-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 129294626 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-10-methyl-6-methylidene-5,14-dioxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 2-methoxy-2-naphthalen-2-ylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C/C(C)=C\[C@@H](OC(=O)C(C)(OC)c4ccc5ccccc5c4)[C@H]12)OC3=O |
| InChI | InChI=1S/C29H28O7/c1-16-11-22-14-20(27(31)34-22)15-24-25(17(2)26(30)35-24)23(12-16)36-28(32)29(3,33-4)21-10-9-18-7-5-6-8-19(18)13-21/h5-10,12-14,22-25H,2,11,15H2,1,3-4H3/b16-12-/t22-,23-,24+,25+,29?/m1/s1 |
| InChIKey | PBZZGZZXUWBIQJ-FEGWXOPISA-N |
| XLogP | 4.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|