C20H22O5 — CID 129289547
[(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] cyclopropanecarboxylate (PubChem CID 129289547) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] cyclopropanecarboxylate.
| Compound Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 129289547 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(7R,8R,9E,12R)-10-methyl-5,6-dimethylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] cyclopropanecarboxylate |
| SMILES | C=C1OC2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)C4CC4)[C@@H]2C1=C)OC3=O |
| InChI | InChI=1S/C20H22O5/c1-10-6-15-8-14(20(22)24-15)9-17-18(11(2)12(3)23-17)16(7-10)25-19(21)13-4-5-13/h7-8,13,15-18H,2-6,9H2,1H3/b10-7+/t15-,16-,17?,18+/m1/s1 |
| InChIKey | XHALYZJCKVHAEX-KJPGTDSZSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|