C26H40N2O2 — CID 129295837
(Z)-N-[3-[(3E,5E)-hepta-1,3,5-trien-3-yl]oxypropyl]-5-[(Z)-3-methoxyprop-1-enyl]-1-pyrrolidin-1-yloct-5-en-7-yn-3-amine (PubChem CID 129295837) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (Z)-N-[3-[(3E,5E)-hepta-1,3,5-trien-3-yl]oxypropyl]-5-[(Z)-3-methoxyprop-1-enyl]-1-pyrrolidin-1-yloct-5-en-7-yn-3-amine.
| Compound Name | (Z)-N-[3-[(3E,5E)-hepta-1,3,5-trien-3-yl]oxypropyl]-5-[(Z)-3-methoxyprop-1-enyl]-1-pyrrolidin-1-yloct-5-en-7-yn-3-amine |
|---|---|
| PubChem CID | 129295837 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | (Z)-N-[3-[(3E,5E)-hepta-1,3,5-trien-3-yl]oxypropyl]-5-[(Z)-3-methoxyprop-1-enyl]-1-pyrrolidin-1-yloct-5-en-7-yn-3-amine |
| SMILES | C#C/C=C(\C=C/COC)CC(CCN1CCCC1)NCCCO/C(C=C)=C/C=C/C |
| InChI | InChI=1S/C26H40N2O2/c1-5-8-15-26(7-3)30-22-12-17-27-25(16-20-28-18-9-10-19-28)23-24(13-6-2)14-11-21-29-4/h2,5,7-8,11,13-15,25,27H,3,9-10,12,16-23H2,1,4H3/b8-5+,14-11-,24-13+,26-15+ |
| InChIKey | SBAOGGRETXMVAD-QEZGJBHLSA-N |
| XLogP | 4.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|