C22H24N6O3 — CID 129297594
(E)-3-amino-2-(5-cyanopyrimidin-2-yl)-N-(2,2-dimethyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl)prop-2-enamide (PubChem CID 129297594) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is (E)-3-amino-2-(5-cyanopyrimidin-2-yl)-N-(2,2-dimethyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl)prop-2-enamide.
| Compound Name | (E)-3-amino-2-(5-cyanopyrimidin-2-yl)-N-(2,2-dimethyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 129297594 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (E)-3-amino-2-(5-cyanopyrimidin-2-yl)-N-(2,2-dimethyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl)prop-2-enamide |
| SMILES | CC1(C)Cc2cc(NC(=O)/C(=C/N)c3ncc(C#N)cn3)c(N3CCOCC3)cc2O1 |
| InChI | InChI=1S/C22H24N6O3/c1-22(2)9-15-7-17(18(8-19(15)31-22)28-3-5-30-6-4-28)27-21(29)16(11-24)20-25-12-14(10-23)13-26-20/h7-8,11-13H,3-6,9,24H2,1-2H3,(H,27,29)/b16-11+ |
| InChIKey | HOYNMUQDHZGRIR-LFIBNONCSA-N |
| XLogP | 1.84 |
| TPSA | 126.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|