C24H27FN6O4 — CID 129297770
(E)-3-amino-N-[2-[(3R,4S)-3-fluorooxan-4-yl]-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-pyrimidin-2-ylprop-2-enamide (PubChem CID 129297770) has the molecular formula C24H27FN6O4 and a molecular weight of 482.52 g/mol. Its IUPAC name is (E)-3-amino-N-[2-[(3R,4S)-3-fluorooxan-4-yl]-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-pyrimidin-2-ylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[2-[(3R,4S)-3-fluorooxan-4-yl]-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-pyrimidin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 129297770 |
| Molecular Formula | C24H27FN6O4 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (E)-3-amino-N-[2-[(3R,4S)-3-fluorooxan-4-yl]-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-pyrimidin-2-ylprop-2-enamide |
| SMILES | N/C=C(/C(=O)Nc1cc2c(cc1N1CCOCC1)C(=O)N([C@H]1CCOC[C@@H]1F)C2)c1ncccn1 |
| InChI | InChI=1S/C24H27FN6O4/c25-18-14-35-7-2-20(18)31-13-15-10-19(29-23(32)17(12-26)22-27-3-1-4-28-22)21(11-16(15)24(31)33)30-5-8-34-9-6-30/h1,3-4,10-12,18,20H,2,5-9,13-14,26H2,(H,29,32)/b17-12+/t18-,20-/m0/s1 |
| InChIKey | GMSURCPYNPKPMA-PUKKJSDOSA-N |
| XLogP | 1.33 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|