C22H25N5O3 — CID 159507699
3-amino-N-(2,2-dimethyl-6-morpholin-4-yl-1-oxo-3H-inden-5-yl)-2-pyrimidin-2-ylprop-2-enamide (PubChem CID 159507699) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethyl-6-morpholin-4-yl-1-oxo-3H-inden-5-yl)-2-pyrimidin-2-ylprop-2-enamide.
| Compound Name | 3-amino-N-(2,2-dimethyl-6-morpholin-4-yl-1-oxo-3H-inden-5-yl)-2-pyrimidin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 159507699 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-amino-N-(2,2-dimethyl-6-morpholin-4-yl-1-oxo-3H-inden-5-yl)-2-pyrimidin-2-ylprop-2-enamide |
| SMILES | CC1(C)Cc2cc(NC(=O)C(=CN)c3ncccn3)c(N3CCOCC3)cc2C1=O |
| InChI | InChI=1S/C22H25N5O3/c1-22(2)12-14-10-17(26-21(29)16(13-23)20-24-4-3-5-25-20)18(11-15(14)19(22)28)27-6-8-30-9-7-27/h3-5,10-11,13H,6-9,12,23H2,1-2H3,(H,26,29) |
| InChIKey | RYVUDHMPLPFUHI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|