C16H22N2O5S — CID 129298151
3-ethyl-2,2-dimethyl-6-morpholin-4-yl-5-nitro-3H-1-benzothiophene 1,1-dioxide (PubChem CID 129298151) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 3-ethyl-2,2-dimethyl-6-morpholin-4-yl-5-nitro-3H-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-ethyl-2,2-dimethyl-6-morpholin-4-yl-5-nitro-3H-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 129298151 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-ethyl-2,2-dimethyl-6-morpholin-4-yl-5-nitro-3H-1-benzothiophene 1,1-dioxide |
| SMILES | CCC1c2cc([N+](=O)[O-])c(N3CCOCC3)cc2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C16H22N2O5S/c1-4-12-11-9-14(18(19)20)13(17-5-7-23-8-6-17)10-15(11)24(21,22)16(12,2)3/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | OIRFQXMEKVEFLN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|